Products 572-46-3
CAS 572-46-3 is the registry number for N-Acetyl-S-(9,10-dihydro-10-hydroxy-9-phenanthrenyl)-L-cysteine. Offered by: TRC. Available pack sizes: 25mg.
(2R)-2-acetamido-3-[(10-hydroxy-9,10-dihydrophenanthren-9-yl)sulfanyl]propanoic acid (CAS 572-46-3) is a chemical compound with the molecular formula C19H19NO4S and a molecular weight of 357.4 g/mol. IUPAC name: (2R)-2-acetamido-3-[(10-hydroxy-9,10-dihydrophenanthren-9-yl)sulfanyl]propanoic acid. InChIKey: HDPUVQANFUQYKU-AOCRQIFASA-N.
| Molecular formula | C19H19NO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2R)-2-acetamido-3-[(10-hydroxy-9,10-dihydrophenanthren-9-yl)sulfanyl]propanoic acid |
| InChIKey | HDPUVQANFUQYKU-AOCRQIFASA-N |
| SMILES | CC(=O)N[C@@H](CSC1C(C2=CC=CC=C2C3=CC=CC=C13)O)C(=O)O |
Computed by PubChem (NCBI)