Products 3026677-40-4
CAS 3026677-40-4 is the registry number for Isopropyl 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonate (Palbociclib Impurity), 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg.
Propan-2-yl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate (CAS 3026677-40-4) is a chemical compound with the molecular formula C19H19NO4S and a molecular weight of 357.4 g/mol. IUPAC name: propan-2-yl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate. InChIKey: SKKTVNNIOUMTPU-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | propan-2-yl 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonate |
| InChIKey | SKKTVNNIOUMTPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)OC(C)C |
Computed by PubChem (NCBI)