Products 82352-70-3
CAS 82352-70-3 is the registry number for 1',3',3'-Trimethylspiro[chromene-2,2'-indoline]-6-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-sulfonic acid (CAS 82352-70-3) is a chemical compound with the molecular formula C19H19NO4S and a molecular weight of 357.4 g/mol. IUPAC name: 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-sulfonic acid. InChIKey: MNMJLUVBDVNUCL-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-sulfonic acid |
| InChIKey | MNMJLUVBDVNUCL-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C13C=CC4=C(O3)C=CC(=C4)S(=O)(=O)O)C)C |
Computed by PubChem (NCBI)