CAS 30842-48-9 is the registry number for N-Destrimethylamine Diltiazem. Offered by: TRC. Available pack sizes: 250mg.
[(2S,3S)-2-(4-methoxyphenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (CAS 30842-48-9) is a chemical compound with the molecular formula C19H19NO4S and a molecular weight of 357.4 g/mol. IUPAC name: [(2S,3S)-2-(4-methoxyphenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate. InChIKey: MFCZBHLJRYFCFO-MSOLQXFVSA-N.
| Molecular formula | C19H19NO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | [(2S,3S)-2-(4-methoxyphenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| InChIKey | MFCZBHLJRYFCFO-MSOLQXFVSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](SC2=CC=CC=C2N(C1=O)C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)