Products 1932046-33-7
CAS 1932046-33-7 appears in our catalog under these names: (2S)-2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-2-methyl-3-sulfanylpropanoic acid, Fmoc-α-Me-D-Cys-OH 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 50mg, 25mg, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-sulfanylpropanoic acid (CAS 1932046-33-7) is a chemical compound with the molecular formula C19H19NO4S and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-sulfanylpropanoic acid. InChIKey: UJPVDWLZTVBWLC-LJQANCHMSA-N.
| Molecular formula | C19H19NO4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-sulfanylpropanoic acid |
| InChIKey | UJPVDWLZTVBWLC-LJQANCHMSA-N |
| SMILES | C[C@@](CS)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)