CAS 1710345-30-4 appears in our catalog under these names: 2,2-Difluoro-1-(3-methylphenyl)cyclopropane-1-carboxylic acid, 98%, 2,2-Difluoro-1-(3-methylphenyl)cyclopropane-1-carboxylic acid, 2,2-Difluoro-1-(m-tolyl)cyclopropane-1-carboxylic acid, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 500mg.
2,2-difluoro-1-(3-methylphenyl)cyclopropane-1-carboxylic acid (CAS 1710345-30-4) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2,2-difluoro-1-(3-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: VFRCSWBZBZWREG-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 2,2-difluoro-1-(3-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | VFRCSWBZBZWREG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2(CC2(F)F)C(=O)O |
Computed by PubChem (NCBI)