CAS 171336-76-8 is the registry number for 1-Benzyl-APDC. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylic acid (CAS 171336-76-8) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylic acid. InChIKey: LYCSUAGKQMUTBR-ZWNOBZJWSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2R,4R)-4-amino-1-benzylpyrrolidine-2,4-dicarboxylic acid |
| InChIKey | LYCSUAGKQMUTBR-ZWNOBZJWSA-N |
| SMILES | C1[C@@H](N(C[C@]1(C(=O)O)N)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)