CAS 172217-16-2 is the registry number for Ethyl 2-chloro-6-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-chloro-6-nitrobenzoate (CAS 172217-16-2) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: ethyl 2-chloro-6-nitrobenzoate. InChIKey: DSVPOQALVJHYNO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | ethyl 2-chloro-6-nitrobenzoate |
| InChIKey | DSVPOQALVJHYNO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)