CAS 17228-99-8 appears in our catalog under these names: 2-(4-Methylphenyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(4-Methylphenyl)-1,3-thiazole-4-carboxylic acid, 2-(4-Methylphenyl)-1,3-thiazole-4-carboxylic acid, 97% , 2-(4-METHYLPHENYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID, 97%, 97%, 2-(4-Methylphenyl)-1,3-thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
2-(4-methylphenyl)-1,3-thiazole-4-carboxylic acid (CAS 17228-99-8) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-(4-methylphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: MTVWIZYQYPRZGZ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-(4-methylphenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | MTVWIZYQYPRZGZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)