Products 173043-38-4
CAS 173043-38-4 appears in our catalog under these names: 2-Amino-3-carboxy-1,4-naphthoquinone, 97%, 2–Amino–3–carboxy–1,4–naphthoquinone, 2-Amino-3-carboxy-1,4-naphthoquinone, 2-Amino-3-carboxy-1,4-naphthoquinone, ≥98%, ≥98%, 2-Amino-3-carboxy-1,4-naphthoquinone, 99.59%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 25mg, 1 mg, 5 mg.
1-hydroxy-3-imino-4-oxonaphthalene-2-carboxylic acid (CAS 173043-38-4) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 1-hydroxy-3-imino-4-oxonaphthalene-2-carboxylic acid. InChIKey: LUUNBSJOKUEDSL-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 1-hydroxy-3-imino-4-oxonaphthalene-2-carboxylic acid |
| InChIKey | LUUNBSJOKUEDSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=N)C2=O)C(=O)O)O |
Computed by PubChem (NCBI)