Products 17349-64-3
CAS 17349-64-3 appears in our catalog under these names: 7-Methyl-1-benzofuran-2-carboxylic acid, 95%, 7-Methylbenzofuran-2-carboxylic acid, 97%, 7-methylbenzofuran-2-carboxylic acid, 7-methylbenzofuran-2-carboxylic acid, 97%, 97%, 7-methyl-1-benzofuran-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 5g, 10g.
7-methyl-1-benzofuran-2-carboxylic acid (CAS 17349-64-3) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methyl-1-benzofuran-2-carboxylic acid. InChIKey: ZGVCUDGNUWNJDI-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | ZGVCUDGNUWNJDI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)