CAS 175137-09-4 is the registry number for 6-(4-Chlorophenyl)pyrimidine-2,4-diamine, 95+%. Offered by: Fluorochem. Available pack sizes: 1g.
6-(4-chlorophenyl)pyrimidine-2,4-diamine (CAS 175137-09-4) is a chemical compound with the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. IUPAC name: 6-(4-chlorophenyl)pyrimidine-2,4-diamine. InChIKey: RGQMMCAWKASJGS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4 |
|---|---|
| Molecular weight | 220.66 g/mol |
| IUPAC name | 6-(4-chlorophenyl)pyrimidine-2,4-diamine |
| InChIKey | RGQMMCAWKASJGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC(=N2)N)N)Cl |
Computed by PubChem (NCBI)