CAS 175168-72-6 appears in our catalog under these names: Trans-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid, 95%, Trans-2-(3-fluoro-phenyl)-cyclopropanecarboxylic acid, rel-(1R,2R)-2-(3-Fluorophenyl)cyclopropane-1-carboxylic acid 97%, Rel-(1R,2R)-2-(3-Fluorophenyl)Cyclopropane-1-Carboxylic Acid, 97%, 97%, (1S,2S)-2-(3-FLUOROPHENYL)CYCLOPROPANE-1-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 50mg, 0,5g.
Trans-(1R,2R)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 175168-72-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: trans-(1R,2R)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: WRSJNCVKPWFCPM-DTWKUNHWSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WRSJNCVKPWFCPM-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)