CAS 175202-57-0 is the registry number for Ethyl 5-cyano-3,4-dimethylthieno[2,3-b]thiophene-2-carboxylate, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
Ethyl 2-cyano-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate (CAS 175202-57-0) is a chemical compound with the molecular formula C12H11NO2S2 and a molecular weight of 265.4 g/mol. IUPAC name: ethyl 2-cyano-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate. InChIKey: AVADGSSQORDQMY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | ethyl 2-cyano-3,4-dimethylthieno[2,3-b]thiophene-5-carboxylate |
| InChIKey | AVADGSSQORDQMY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)SC(=C2C)C#N)C |
Computed by PubChem (NCBI)