CAS 541542-47-6 appears in our catalog under these names: 2-(Benzylsulfanyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(Benzylsulfanyl)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-benzylsulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 541542-47-6) is a chemical compound with the molecular formula C12H11NO2S2 and a molecular weight of 265.4 g/mol. IUPAC name: 2-benzylsulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: YWZJTXVYSLYDLF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | 2-benzylsulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | YWZJTXVYSLYDLF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)SCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)