Products 929974-69-6

CAS 929974-69-6 is the registry number for 2-([(2-Methyl-1,3-thiazol-4-yl)methyl]thio)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoic acid (CAS 929974-69-6) is a chemical compound with the molecular formula C12H11NO2S2 and a molecular weight of 265.4 g/mol. IUPAC name: 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoic acid. InChIKey: RHVVLUPGDJHJEX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2S2
Molecular weight265.4 g/mol
IUPAC name2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoic acid
InChIKeyRHVVLUPGDJHJEX-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)CSC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)