CAS 743452-52-0 appears in our catalog under these names: 4-([(4-Methyl-1,3-thiazol-2-yl)thio]methyl)benzoic acid, 95%, 4-{((4-methyl-1,3-thiazol-2-yl)sulfanyl)methyl}benzoic acid, 95%, 4-{((4-Methyl-1,3-thiazol-2-yl)sulfanyl)methyl}benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g.
4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoic acid (CAS 743452-52-0) is a chemical compound with the molecular formula C12H11NO2S2 and a molecular weight of 265.4 g/mol. IUPAC name: 4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoic acid. InChIKey: NODWFSIKRNTPCY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoic acid |
| InChIKey | NODWFSIKRNTPCY-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)SCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)