CAS 554407-96-4 is the registry number for 2-(4-(4-Methylphenyl)-2-sulfanylidene-2,3-dihydro-1,3-thiazol-3-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (CAS 554407-96-4) is a chemical compound with the molecular formula C12H11NO2S2 and a molecular weight of 265.4 g/mol. IUPAC name: 2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid. InChIKey: SWOREMOVUSWJRL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | 2-[4-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| InChIKey | SWOREMOVUSWJRL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=S)N2CC(=O)O |
Computed by PubChem (NCBI)