CAS 929975-68-8 appears in our catalog under these names: 4-([(2-Methyl-1,3-thiazol-4-yl)methyl]thio)benzoic acid, 95%, 4-{((2-methyl-1,3-thiazol-4-yl)methyl)sulfanyl}benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoic acid (CAS 929975-68-8) is a chemical compound with the molecular formula C12H11NO2S2 and a molecular weight of 265.4 g/mol. IUPAC name: 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoic acid. InChIKey: XVQDEHGZVIANBD-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S2 |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoic acid |
| InChIKey | XVQDEHGZVIANBD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)CSC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)