CAS 175204-90-7 appears in our catalog under these names: 6-(2,2,2-Trifluoroethoxy)nicotinic acid, 95% , 6-(2,2,2-Trifluoroethoxy)nicotinic acid, 98%, 98%, 6-(2,2,2-Trifluoroethoxy)pyridine-3-carboxylic acid, 95%. Offered by: Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 250MG, 1g, 5g, 2.5g, 10g, 25g.
6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid (CAS 175204-90-7) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid. InChIKey: GZOOLXWQKURRPU-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid |
| InChIKey | GZOOLXWQKURRPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)