CAS 175205-45-5 appears in our catalog under these names: 1-(2-Chlorobenzyl)-5-oxopyrrolidine-3-carboxylic acid, 98%, 1-(2-Chlorobenzyl)-5-oxopyrrolidine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 2g.
1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 175205-45-5) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: PUUMWLAHRHUIBU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | PUUMWLAHRHUIBU-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)