CAS 62522-91-2 is the registry number for 1-(4-Chlorobenzoyl)proline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-1-(4-chlorobenzoyl)pyrrolidine-2-carboxylic acid (CAS 62522-91-2) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: (2S)-1-(4-chlorobenzoyl)pyrrolidine-2-carboxylic acid. InChIKey: NRJWQQXPQMTJHL-JTQLQIEISA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | (2S)-1-(4-chlorobenzoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | NRJWQQXPQMTJHL-JTQLQIEISA-N |
| SMILES | C1C[C@H](N(C1)C(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)