CAS 42065-10-1 appears in our catalog under these names: 2-Chloro-5,6,8-trimethoxyquinoline, 95%, 2–Chloro–5,6,8–trimethoxyquinoline, 2-Chloro-5,6,8-trimethoxyquinoline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g.
2-chloro-5,6,8-trimethoxyquinoline (CAS 42065-10-1) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 2-chloro-5,6,8-trimethoxyquinoline. InChIKey: GSHDPJKVWVTPDI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 2-chloro-5,6,8-trimethoxyquinoline |
| InChIKey | GSHDPJKVWVTPDI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=C1N=C(C=C2)Cl)OC)OC |
Computed by PubChem (NCBI)