Products 216217-20-8

CAS 216217-20-8 is the registry number for 5-Chloro-1-(2-methoxyethyl)-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-1-(2-methoxyethyl)indole-2-carboxylic acid (CAS 216217-20-8) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 5-chloro-1-(2-methoxyethyl)indole-2-carboxylic acid. InChIKey: NNKVVQATCLRGON-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO3
Molecular weight253.68 g/mol
IUPAC name5-chloro-1-(2-methoxyethyl)indole-2-carboxylic acid
InChIKeyNNKVVQATCLRGON-UHFFFAOYSA-N
SMILESCOCCN1C2=C(C=C(C=C2)Cl)C=C1C(=O)O

Computed by PubChem (NCBI)