Products 2126163-13-9

CAS 2126163-13-9 is the registry number for 6-methoxy-2-methylquinoline-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

6-methoxy-2-methylquinoline-3-carboxylic acid;hydrochloride (CAS 2126163-13-9) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 6-methoxy-2-methylquinoline-3-carboxylic acid;hydrochloride. InChIKey: RIBDEMCRFQQKDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO3
Molecular weight253.68 g/mol
IUPAC name6-methoxy-2-methylquinoline-3-carboxylic acid;hydrochloride
InChIKeyRIBDEMCRFQQKDQ-UHFFFAOYSA-N
SMILESCC1=C(C=C2C=C(C=CC2=N1)OC)C(=O)O.Cl

Computed by PubChem (NCBI)