CAS 2677030-99-6 is the registry number for 8-Chloro-1,5-dihydrospiro[benzo[b]azepine-4,2'-[1,3]dioxolan]-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8'-chlorospiro[1,3-dioxolane-2,4'-3,5-dihydro-1H-1-benzazepine]-2'-one (CAS 2677030-99-6) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 8'-chlorospiro[1,3-dioxolane-2,4'-3,5-dihydro-1H-1-benzazepine]-2'-one. InChIKey: RQXBFPCUQKTUEG-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 8'-chlorospiro[1,3-dioxolane-2,4'-3,5-dihydro-1H-1-benzazepine]-2'-one |
| InChIKey | RQXBFPCUQKTUEG-UHFFFAOYSA-N |
| SMILES | C1COC2(O1)CC3=C(C=C(C=C3)Cl)NC(=O)C2 |
Computed by PubChem (NCBI)