CAS 175277-11-9 appears in our catalog under these names: 3–tert–Butyl–1–methylpyrazole–5–carboxylic Acid, 3-(tert-Butyl)-1-methyl-1H-pyrazole-carboxylic acid, 95%, 3-(tert-Butyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 95% , 3-(tert-Butyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 98%, 98%, 3-tert-Butyl-1-methyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: GLPBio, Thermo Scientific (Acros), Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 50g, 1g, 10g, 250mg, 100mg.
3-tert-butyl-1-methylpyrazole-5-carboxylic acid (CAS 175277-11-9) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-tert-butyl-1-methylpyrazole-5-carboxylic acid. InChIKey: SFSXXMXHJOSBAZ-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-tert-butyl-1-methylpyrazole-5-carboxylic acid |
| InChIKey | SFSXXMXHJOSBAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)C(=O)O)C |
Computed by PubChem (NCBI)