CAS 17609-52-8 appears in our catalog under these names: Cbz-D-(-)-Phenylglycine, Z–D–Phg–OH, Z-D-Phg-OH, N-Carbobenzoxy-D-2-phenylglycine, >98.0%(HPLC), Cbz-D-Phg-OH 98%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 100mg, 10mg, 50mg, 10g, 5g, 25g, 1g, 100g.
(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid (CAS 17609-52-8) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: RLDJWBVOZVJJOS-CQSZACIVSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2R)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | RLDJWBVOZVJJOS-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)