CAS 53990-33-3 appears in our catalog under these names: Z-L-Phenylglycine, Z–Phg–OH, Z-L-Phg-OH, N-Carbobenzoxy-L-2-phenylglycine, >98.0%(HPLC)(T), Cbz-L-(+)-Phenylglycine. Offered by: TRC, GLPBio, Iris Biotech, TCI, Biosynth. Available pack sizes: 10g, 25g, 5g, 100g, 1g, 50g, 250g, 500g.
(2S)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid (CAS 53990-33-3) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (2S)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid. InChIKey: RLDJWBVOZVJJOS-AWEZNQCLSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2S)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid |
| InChIKey | RLDJWBVOZVJJOS-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)