CAS 176204-51-6 appears in our catalog under these names: 2-[1-(4-Fluorobenzyl)-1h-indol-3-yl]acetic acid, 95%, 2–(1–(4–Fluorobenzyl)–1H–indol–3–yl)acetic Acid, 2-(1-(4-Fluorobenzyl)-1H-indol-3-yl)acetic acid. Offered by: Combi-blocks, GLPBio, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 1mg, 5mg, 5 mg, 1 mg.
2-[1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid (CAS 176204-51-6) is a chemical compound with the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. IUPAC name: 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid. InChIKey: MSECUWYFWKAGLD-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO2 |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]acetic acid |
| InChIKey | MSECUWYFWKAGLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)F)CC(=O)O |
Computed by PubChem (NCBI)