CAS 290832-31-4 appears in our catalog under these names: 3-(5-Fluoro-2-phenyl-1H-indol-3-yl)propanoic acid, 97%, 3-(5-FLUORO-2-PHENYL-1H-INDOL-3-YL)PROPANOIC ACID, ≥95%, ≥95%, 3-(5-Fluoro-2-phenyl-1h-indol-3-yl)propanoic acid, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoic acid (CAS 290832-31-4) is a chemical compound with the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. IUPAC name: 3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoic acid. InChIKey: OLRWQHZTBMDOHC-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO2 |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 3-(5-fluoro-2-phenyl-1H-indol-3-yl)propanoic acid |
| InChIKey | OLRWQHZTBMDOHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=C(N2)C=CC(=C3)F)CCC(=O)O |
Computed by PubChem (NCBI)