CAS 86776-51-4 appears in our catalog under these names: 4–Cyano–3–fluorophenyl 4–Propylbenzoate, 4-Cyano-3-fluorophenyl 4-propylbenzoate, ≥98%, 4-Cyano-3-fluorophenyl 4-propylbenzoate, 97%, 4-Cyano-3-fluorophenyl 4-Propylbenzoate, >98.0%(GC), 4-Cyano-3-fluorophenyl-4-propylbenzoate, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, TCI, Chemat. Available pack sizes: 25g, 5g, 1g.
(4-cyano-3-fluorophenyl) 4-propylbenzoate (CAS 86776-51-4) is a chemical compound with the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. IUPAC name: (4-cyano-3-fluorophenyl) 4-propylbenzoate. InChIKey: RDPCRVRASQOZBX-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO2 |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | (4-cyano-3-fluorophenyl) 4-propylbenzoate |
| InChIKey | RDPCRVRASQOZBX-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C(=O)OC2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)