Products 1787916-23-7

CAS 1787916-23-7 is the registry number for 1-(2-Fluorobenzyl)-2-methyl-1H-indole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

1-[(2-fluorophenyl)methyl]-2-methylindole-3-carboxylic acid (CAS 1787916-23-7) is a chemical compound with the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]-2-methylindole-3-carboxylic acid. InChIKey: QVISAQHGBMHJQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14FNO2
Molecular weight283.30 g/mol
IUPAC name1-[(2-fluorophenyl)methyl]-2-methylindole-3-carboxylic acid
InChIKeyQVISAQHGBMHJQJ-UHFFFAOYSA-N
SMILESCC1=C(C2=CC=CC=C2N1CC3=CC=CC=C3F)C(=O)O

Computed by PubChem (NCBI)