Products 869472-64-0
CAS 869472-64-0 is the registry number for 3-[2-(4-Fluorophenyl)-1h-indol-3-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoic acid (CAS 869472-64-0) is a chemical compound with the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. IUPAC name: 3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoic acid. InChIKey: YKHLOIXZUIBBHT-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO2 |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]propanoic acid |
| InChIKey | YKHLOIXZUIBBHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=CC=C(C=C3)F)CCC(=O)O |
Computed by PubChem (NCBI)