CAS 340318-78-7 is the registry number for 1-[2-(4-Fluorophenoxy)ethyl]-1h-indole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[2-(4-fluorophenoxy)ethyl]indole-3-carbaldehyde (CAS 340318-78-7) is a chemical compound with the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. IUPAC name: 1-[2-(4-fluorophenoxy)ethyl]indole-3-carbaldehyde. InChIKey: LZDGENIAAFJSHO-UHFFFAOYSA-N.
| Molecular formula | C17H14FNO2 |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 1-[2-(4-fluorophenoxy)ethyl]indole-3-carbaldehyde |
| InChIKey | LZDGENIAAFJSHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CCOC3=CC=C(C=C3)F)C=O |
Computed by PubChem (NCBI)