CAS 17630-79-4 is the registry number for 5,7-Dichloroindolin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-1,2-dihydroindol-3-one (CAS 17630-79-4) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 5,7-dichloro-1,2-dihydroindol-3-one. InChIKey: UZKCQVCNQJKBCY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 5,7-dichloro-1,2-dihydroindol-3-one |
| InChIKey | UZKCQVCNQJKBCY-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(N1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)