CAS 176446-91-6 is the registry number for 4-(Pyridin-3-yl)butanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-pyridin-3-ylbutanoic acid;hydrochloride (CAS 176446-91-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 4-pyridin-3-ylbutanoic acid;hydrochloride. InChIKey: BIAUXLCJVRFGCK-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 4-pyridin-3-ylbutanoic acid;hydrochloride |
| InChIKey | BIAUXLCJVRFGCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CCCC(=O)O.Cl |
Computed by PubChem (NCBI)