CAS 17700-55-9 is the registry number for N-(2,6-Dichloro-3-methylphenyl)acetamide, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, on request.
N-(2,6-dichloro-3-methylphenyl)acetamide (CAS 17700-55-9) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: N-(2,6-dichloro-3-methylphenyl)acetamide. InChIKey: CJKDFKCEXKPCBM-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | N-(2,6-dichloro-3-methylphenyl)acetamide |
| InChIKey | CJKDFKCEXKPCBM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)NC(=O)C)Cl |
Computed by PubChem (NCBI)