CAS 177034-24-1 is the registry number for 4-Chloro-2-fluoro-5-methoxy benzaldehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 50mg.
4-chloro-2-fluoro-5-methoxybenzaldehyde (CAS 177034-24-1) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 4-chloro-2-fluoro-5-methoxybenzaldehyde. InChIKey: XWPDQEBSWPVPKG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 4-chloro-2-fluoro-5-methoxybenzaldehyde |
| InChIKey | XWPDQEBSWPVPKG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)F)Cl |
Computed by PubChem (NCBI)