CAS 17730-74-4 appears in our catalog under these names: 6-Hydroxyquinazoline-2,4(1h,3h)-dione, 95%, 6-Hydroxyquinazoline-2,4(1H,3H)-dione, 97%, 6–Hydroxyquinazoline–2,4(1H,3H)–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
6-hydroxy-1H-quinazoline-2,4-dione (CAS 17730-74-4) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 6-hydroxy-1H-quinazoline-2,4-dione. InChIKey: MOTVHUMFMLEKPA-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 6-hydroxy-1H-quinazoline-2,4-dione |
| InChIKey | MOTVHUMFMLEKPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)