CAS 17746-75-7 appears in our catalog under these names: 3-Bromo-2-hydroxy-5-methylbenzoic acid 97%, 3-Bromo-2-hydroxy-5-methylbenzoic acid, 97%, 97%, 3-Bromo-2-hydroxy-5-methylbenzoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-2-hydroxy-5-methylbenzoic acid (CAS 17746-75-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-2-hydroxy-5-methylbenzoic acid. InChIKey: POGDQQPHOPNJFP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-2-hydroxy-5-methylbenzoic acid |
| InChIKey | POGDQQPHOPNJFP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)O)C(=O)O |
Computed by PubChem (NCBI)