CAS 177736-15-1 appears in our catalog under these names: (6–methoxynaphthalen–2–yl)methanamine, (6-Methoxynaphthalen-2-yl)methanamine. Offered by: GLPBio, Biosynth. Available pack sizes: 200mg, 250mg, 2,5g.
(6-methoxynaphthalen-2-yl)methanamine (CAS 177736-15-1) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: (6-methoxynaphthalen-2-yl)methanamine. InChIKey: MCCAWZYURZFQOX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (6-methoxynaphthalen-2-yl)methanamine |
| InChIKey | MCCAWZYURZFQOX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CN |
Computed by PubChem (NCBI)