CAS 1780187-45-2 appears in our catalog under these names: 4–Bromo–5–fluoro–2–methoxybenzoic acid, 4-Bromo-5-fluoro-2-methoxybenzoic acid, 4-Bromo-5-fluoro-2-methoxybenzoic acid 97%, 4-Bromo-5-fluoro-2-methoxybenzoic acid, 98%, 4-Bromo-5-fluoro-2-methoxybenzoic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 10g, 1g, 50mg, 250mg, 5g.
4-bromo-5-fluoro-2-methoxybenzoic acid (CAS 1780187-45-2) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 4-bromo-5-fluoro-2-methoxybenzoic acid. InChIKey: BCNABXVPXFZMFO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-methoxybenzoic acid |
| InChIKey | BCNABXVPXFZMFO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)F)Br |
Computed by PubChem (NCBI)