Products 1780253-13-5
CAS 1780253-13-5 is the registry number for 4-chloro-1H-pyrazolo[3,4-b]pyridine-6-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4-chloro-1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid (CAS 1780253-13-5) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 4-chloro-1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid. InChIKey: XWZJUHTZRZEIDK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 4-chloro-1H-pyrazolo[5,4-b]pyridine-6-carboxylic acid |
| InChIKey | XWZJUHTZRZEIDK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NN=C2)N=C1C(=O)O)Cl |
Computed by PubChem (NCBI)