Products 1780820-78-1
CAS 1780820-78-1 is the registry number for 8-Chloro-7-fluoro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline (CAS 1780820-78-1) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: 8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline. InChIKey: DEDASJIPLOIEMG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | 8-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline |
| InChIKey | DEDASJIPLOIEMG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(C=C2)F)Cl)NC1 |
Computed by PubChem (NCBI)