Products 1781071-32-6

CAS 1781071-32-6 is the registry number for 4-Bromo-3-fluoro-5-methoxybenzoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

4-bromo-3-fluoro-5-methoxybenzoic acid (CAS 1781071-32-6) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 4-bromo-3-fluoro-5-methoxybenzoic acid. InChIKey: OATUTFDPSFZYAC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrFO3
Molecular weight249.03 g/mol
IUPAC name4-bromo-3-fluoro-5-methoxybenzoic acid
InChIKeyOATUTFDPSFZYAC-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)C(=O)O)F)Br

Computed by PubChem (NCBI)