CAS 1781625-83-9 is the registry number for 2-chloro-6-hydroxy-3-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-chloro-6-hydroxy-3-methylbenzoic acid (CAS 1781625-83-9) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-6-hydroxy-3-methylbenzoic acid. InChIKey: PUSAXQJSJPNZRT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-6-hydroxy-3-methylbenzoic acid |
| InChIKey | PUSAXQJSJPNZRT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C(=O)O)Cl |
Computed by PubChem (NCBI)