Products 1781632-91-4
CAS 1781632-91-4 appears in our catalog under these names: 3-(3-Chlorophenyl)cyclobutane-1-carboxylic acid, 97%, 3-(3-chlorophenyl)cyclobutanecarboxylic acid, 97%, 97%, 3-(3-CHLOROPHENYL)CYCLOBUTANECARBOXYLIC ACID, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 500mg, 100mg.
3-(3-chlorophenyl)cyclobutane-1-carboxylic acid (CAS 1781632-91-4) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 3-(3-chlorophenyl)cyclobutane-1-carboxylic acid. InChIKey: IHPNWEGGODMXKK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 3-(3-chlorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | IHPNWEGGODMXKK-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)