Products 1781668-85-6
CAS 1781668-85-6 is the registry number for 2-((tert-Butoxycarbonyl)amino)-1H-imidazole-5-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-imidazole-5-carboxylic acid (CAS 1781668-85-6) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-imidazole-5-carboxylic acid. InChIKey: ZYEPCEUQDSSYNY-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-imidazole-5-carboxylic acid |
| InChIKey | ZYEPCEUQDSSYNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(N1)C(=O)O |
Computed by PubChem (NCBI)