Products 1781783-46-7

CAS 1781783-46-7 is the registry number for 3-Amino-6-bromo-1-benzothiophene-2-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

3-amino-6-bromo-1-benzothiophene-2-carboxylic acid (CAS 1781783-46-7) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: 3-amino-6-bromo-1-benzothiophene-2-carboxylic acid. InChIKey: ZJNYXZSJRIHLMW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO2S
Molecular weight272.12 g/mol
IUPAC name3-amino-6-bromo-1-benzothiophene-2-carboxylic acid
InChIKeyZJNYXZSJRIHLMW-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)SC(=C2N)C(=O)O

Computed by PubChem (NCBI)