CAS 1781783-46-7 is the registry number for 3-Amino-6-bromo-1-benzothiophene-2-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
3-amino-6-bromo-1-benzothiophene-2-carboxylic acid (CAS 1781783-46-7) is a chemical compound with the molecular formula C9H6BrNO2S and a molecular weight of 272.12 g/mol. IUPAC name: 3-amino-6-bromo-1-benzothiophene-2-carboxylic acid. InChIKey: ZJNYXZSJRIHLMW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 3-amino-6-bromo-1-benzothiophene-2-carboxylic acid |
| InChIKey | ZJNYXZSJRIHLMW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2N)C(=O)O |
Computed by PubChem (NCBI)